C10H12FNO2 — CID 16768986
2-[(3-fluorophenyl)methylamino]propanoic acid (PubChem CID 16768986) has the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methylamino]propanoic acid.
| Compound Name | 2-[(3-fluorophenyl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 16768986 |
| Molecular Formula | C10H12FNO2 |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 2-[(3-fluorophenyl)methylamino]propanoic acid |
| SMILES | CC(NCc1cccc(F)c1)C(=O)O |
| InChI | InChI=1S/C10H12FNO2/c1-7(10(13)14)12-6-8-3-2-4-9(11)5-8/h2-5,7,12H,6H2,1H3,(H,13,14) |
| InChIKey | LEVMPCLFKMFMNU-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |