C11H15FN2O — CID 28970574
(2R)-2-[(3-fluorophenyl)methylamino]-N-methylpropanamide (PubChem CID 28970574) has the molecular formula C11H15FN2O and a molecular weight of 210.25 g/mol. Its IUPAC name is (2R)-2-[(3-fluorophenyl)methylamino]-N-methylpropanamide.
| Compound Name | (2R)-2-[(3-fluorophenyl)methylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 28970574 |
| Molecular Formula | C11H15FN2O |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | (2R)-2-[(3-fluorophenyl)methylamino]-N-methylpropanamide |
| SMILES | CNC(=O)[C@@H](C)NCc1cccc(F)c1 |
| InChI | InChI=1S/C11H15FN2O/c1-8(11(15)13-2)14-7-9-4-3-5-10(12)6-9/h3-6,8,14H,7H2,1-2H3,(H,13,15)/t8-/m1/s1 |
| InChIKey | LRFJLHRPYKLBQJ-MRVPVSSYSA-N |
| XLogP | 1.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |