C13H16FNO3 — CID 124887779
(2R)-2-[[(2S)-3-(3-fluorophenyl)-2-methylpropanoyl]amino]propanoic acid (PubChem CID 124887779) has the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. Its IUPAC name is (2R)-2-[[(2S)-3-(3-fluorophenyl)-2-methylpropanoyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[(2S)-3-(3-fluorophenyl)-2-methylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 124887779 |
| Molecular Formula | C13H16FNO3 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (2R)-2-[[(2S)-3-(3-fluorophenyl)-2-methylpropanoyl]amino]propanoic acid |
| SMILES | C[C@@H](Cc1cccc(F)c1)C(=O)N[C@H](C)C(=O)O |
| InChI | InChI=1S/C13H16FNO3/c1-8(12(16)15-9(2)13(17)18)6-10-4-3-5-11(14)7-10/h3-5,7-9H,6H2,1-2H3,(H,15,16)(H,17,18)/t8-,9+/m0/s1 |
| InChIKey | HPHOZCFPOQJJTB-DTWKUNHWSA-N |
| XLogP | 1.59 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |