C11H16NO5P — CID 19801626
2-[[3-(phosphonomethyl)phenyl]methylamino]propanoic acid (PubChem CID 19801626) has the molecular formula C11H16NO5P and a molecular weight of 273.23 g/mol. Its IUPAC name is 2-[[3-(phosphonomethyl)phenyl]methylamino]propanoic acid.
| Compound Name | 2-[[3-(phosphonomethyl)phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 19801626 |
| Molecular Formula | C11H16NO5P |
| Molecular Weight | 273.23 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-[[3-(phosphonomethyl)phenyl]methylamino]propanoic acid |
| SMILES | CC(NCc1cccc(CP(=O)(O)O)c1)C(=O)O |
| InChI | InChI=1S/C11H16NO5P/c1-8(11(13)14)12-6-9-3-2-4-10(5-9)7-18(15,16)17/h2-5,8,12H,6-7H2,1H3,(H,13,14)(H2,15,16,17) |
| InChIKey | NIXBCLPFAOEWQK-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.23 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|