About 2-aminopropanoic acid;benzene;iron
2-aminopropanoic acid;benzene;iron (PubChem CID 174869891) has the molecular formula C9H13FeNO2
and a molecular weight of 223.05 g/mol. Its IUPAC name is 2-aminopropanoic acid;benzene;iron.
Molecular Properties
| Compound Name | 2-aminopropanoic acid;benzene;iron |
| PubChem CID | 174869891 |
| Molecular Formula | C9H13FeNO2 |
| Molecular Weight | 223.05 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 2-aminopropanoic acid;benzene;iron |
| SMILES | CC(N)C(=O)O.[Fe].c1ccccc1 |
| InChI | InChI=1S/C6H6.C3H7NO2.Fe/c1-2-4-6-5-3-1;1-2(4)3(5)6;/h1-6H;2H,4H2,1H3,(H,5,6); |
| InChIKey | MGIJDXIGLFWSHU-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.05 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-aminopropanoic acid;benzene;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopropanoic acid;benzene;iron?
The IUPAC name of 2-aminopropanoic acid;benzene;iron (CID 174869891) is 2-aminopropanoic acid;benzene;iron.
What is the SMILES notation for 2-aminopropanoic acid;benzene;iron?
The canonical SMILES for 2-aminopropanoic acid;benzene;iron is CC(N)C(=O)O.[Fe].c1ccccc1.
What is the InChIKey of 2-aminopropanoic acid;benzene;iron?
The InChIKey is MGIJDXIGLFWSHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6.C3H7NO2.Fe/c1-2-4-6-5-3-1;1-2(4)3(5)6;/h1-6H;2H,4H2,1H3,(H,5,6);.
What are the key properties of 2-aminopropanoic acid;benzene;iron?
2-aminopropanoic acid;benzene;iron has a molecular weight of 223.05 g/mol, XLogP of 1.10, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopropanoic acid;benzene;iron is sourced from PubChem (CID 174869891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).