About (2S)-2-aminopropanoic acid;polane
(2S)-2-aminopropanoic acid;polane (PubChem CID 173022618) has the molecular formula C3H9NO2Po
and a molecular weight of 300.11 g/mol. Its IUPAC name is (2S)-2-aminopropanoic acid;polane.
Molecular Properties
| Compound Name | (2S)-2-aminopropanoic acid;polane |
| PubChem CID | 173022618 |
| Molecular Formula | C3H9NO2Po |
| Molecular Weight | 300.11 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | (2S)-2-aminopropanoic acid;polane |
| SMILES | C[C@H](N)C(=O)O.[PoH2] |
| InChI | InChI=1S/C3H7NO2.Po.2H/c1-2(4)3(5)6;;;/h2H,4H2,1H3,(H,5,6);;;/t2-;;;/m0.../s1 |
| InChIKey | GRJFVZQMDHCIOJ-SQGDDOFFSA-N |
| XLogP | -1.50 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.11 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-aminopropanoic acid;polane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminopropanoic acid;polane?
The IUPAC name of (2S)-2-aminopropanoic acid;polane (CID 173022618) is (2S)-2-aminopropanoic acid;polane.
What is the SMILES notation for (2S)-2-aminopropanoic acid;polane?
The canonical SMILES for (2S)-2-aminopropanoic acid;polane is C[C@H](N)C(=O)O.[PoH2].
What is the InChIKey of (2S)-2-aminopropanoic acid;polane?
The InChIKey is GRJFVZQMDHCIOJ-SQGDDOFFSA-N. The full InChI is InChI=1S/C3H7NO2.Po.2H/c1-2(4)3(5)6;;;/h2H,4H2,1H3,(H,5,6);;;/t2-;;;/m0.../s1.
What are the key properties of (2S)-2-aminopropanoic acid;polane?
(2S)-2-aminopropanoic acid;polane has a molecular weight of 300.11 g/mol, XLogP of -1.50, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminopropanoic acid;polane is sourced from PubChem (CID 173022618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).