About calcium;(2S)-2-aminopropanoic acid;dichloride
calcium;(2S)-2-aminopropanoic acid;dichloride (PubChem CID 173075157) has the molecular formula C3H7CaCl2NO2
and a molecular weight of 200.08 g/mol. Its IUPAC name is calcium;(2S)-2-aminopropanoic acid;dichloride.
Molecular Properties
| Compound Name | calcium;(2S)-2-aminopropanoic acid;dichloride |
| PubChem CID | 173075157 |
| Molecular Formula | C3H7CaCl2NO2 |
| Molecular Weight | 200.08 g/mol |
| Exact Mass | 198.95 |
| IUPAC Name | calcium;(2S)-2-aminopropanoic acid;dichloride |
| SMILES | C[C@H](N)C(=O)O.[Ca+2].[Cl-].[Cl-] |
| InChI | InChI=1S/C3H7NO2.Ca.2ClH/c1-2(4)3(5)6;;;/h2H,4H2,1H3,(H,5,6);;2*1H/q;+2;;/p-2/t2-;;;/m0.../s1 |
| InChIKey | HHVWYLZRAFLGTC-SQGDDOFFSA-L |
| XLogP | -6.95 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.08 |
| LogP ≤ 5 | -6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze calcium;(2S)-2-aminopropanoic acid;dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;(2S)-2-aminopropanoic acid;dichloride?
The IUPAC name of calcium;(2S)-2-aminopropanoic acid;dichloride (CID 173075157) is calcium;(2S)-2-aminopropanoic acid;dichloride.
What is the SMILES notation for calcium;(2S)-2-aminopropanoic acid;dichloride?
The canonical SMILES for calcium;(2S)-2-aminopropanoic acid;dichloride is C[C@H](N)C(=O)O.[Ca+2].[Cl-].[Cl-].
What is the InChIKey of calcium;(2S)-2-aminopropanoic acid;dichloride?
The InChIKey is HHVWYLZRAFLGTC-SQGDDOFFSA-L. The full InChI is InChI=1S/C3H7NO2.Ca.2ClH/c1-2(4)3(5)6;;;/h2H,4H2,1H3,(H,5,6);;2*1H/q;+2;;/p-2/t2-;;;/m0.../s1.
What are the key properties of calcium;(2S)-2-aminopropanoic acid;dichloride?
calcium;(2S)-2-aminopropanoic acid;dichloride has a molecular weight of 200.08 g/mol, XLogP of -6.95, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;(2S)-2-aminopropanoic acid;dichloride is sourced from PubChem (CID 173075157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).