About 1,3-difluorobenzene;methanol
1,3-difluorobenzene;methanol (PubChem CID 144994633) has the molecular formula C7H8F2O
and a molecular weight of 146.14 g/mol. Its IUPAC name is 1,3-difluorobenzene;methanol.
Molecular Properties
| Compound Name | 1,3-difluorobenzene;methanol |
| PubChem CID | 144994633 |
| Molecular Formula | C7H8F2O |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | 1,3-difluorobenzene;methanol |
| SMILES | CO.Fc1cccc(F)c1 |
| InChI | InChI=1S/C6H4F2.CH4O/c7-5-2-1-3-6(8)4-5;1-2/h1-4H;2H,1H3 |
| InChIKey | LOXYWNIQVLAYCI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-difluorobenzene;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-difluorobenzene;methanol?
The IUPAC name of 1,3-difluorobenzene;methanol (CID 144994633) is 1,3-difluorobenzene;methanol.
What is the SMILES notation for 1,3-difluorobenzene;methanol?
The canonical SMILES for 1,3-difluorobenzene;methanol is CO.Fc1cccc(F)c1.
What is the InChIKey of 1,3-difluorobenzene;methanol?
The InChIKey is LOXYWNIQVLAYCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F2.CH4O/c7-5-2-1-3-6(8)4-5;1-2/h1-4H;2H,1H3.
What are the key properties of 1,3-difluorobenzene;methanol?
1,3-difluorobenzene;methanol has a molecular weight of 146.14 g/mol, XLogP of 1.57, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-difluorobenzene;methanol is sourced from PubChem (CID 144994633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).