C12H8F4 — CID 159873588
1,3-difluorobenzene;1,4-difluorobenzene (PubChem CID 159873588) has the molecular formula C12H8F4 and a molecular weight of 228.19 g/mol. Its IUPAC name is 1,3-difluorobenzene;1,4-difluorobenzene.
| Compound Name | 1,3-difluorobenzene;1,4-difluorobenzene |
|---|---|
| PubChem CID | 159873588 |
| Molecular Formula | C12H8F4 |
| Molecular Weight | 228.19 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 1,3-difluorobenzene;1,4-difluorobenzene |
| SMILES | Fc1ccc(F)cc1.Fc1cccc(F)c1 |
| InChI | InChI=1S/2C6H4F2/c7-5-1-2-6(8)4-3-5;7-5-2-1-3-6(8)4-5/h2*1-4H |
| InChIKey | NSPSTMKGFXVGTR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.19 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |