About acetaldehyde;1,3-difluorobenzene
acetaldehyde;1,3-difluorobenzene (PubChem CID 160854263) has the molecular formula C8H8F2O
and a molecular weight of 158.15 g/mol. Its IUPAC name is acetaldehyde;1,3-difluorobenzene.
Molecular Properties
| Compound Name | acetaldehyde;1,3-difluorobenzene |
| PubChem CID | 160854263 |
| Molecular Formula | C8H8F2O |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | acetaldehyde;1,3-difluorobenzene |
| SMILES | CC=O.Fc1cccc(F)c1 |
| InChI | InChI=1S/C6H4F2.C2H4O/c7-5-2-1-3-6(8)4-5;1-2-3/h1-4H;2H,1H3 |
| InChIKey | SJQXALRUOGQSJN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;1,3-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;1,3-difluorobenzene?
The IUPAC name of acetaldehyde;1,3-difluorobenzene (CID 160854263) is acetaldehyde;1,3-difluorobenzene.
What is the SMILES notation for acetaldehyde;1,3-difluorobenzene?
The canonical SMILES for acetaldehyde;1,3-difluorobenzene is CC=O.Fc1cccc(F)c1.
What is the InChIKey of acetaldehyde;1,3-difluorobenzene?
The InChIKey is SJQXALRUOGQSJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F2.C2H4O/c7-5-2-1-3-6(8)4-5;1-2-3/h1-4H;2H,1H3.
What are the key properties of acetaldehyde;1,3-difluorobenzene?
acetaldehyde;1,3-difluorobenzene has a molecular weight of 158.15 g/mol, XLogP of 2.17, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;1,3-difluorobenzene is sourced from PubChem (CID 160854263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).