C7H6F2O2 — CID 158586074
1,3-difluorobenzene;formic acid (PubChem CID 158586074) has the molecular formula C7H6F2O2 and a molecular weight of 160.12 g/mol. Its IUPAC name is 1,3-difluorobenzene;formic acid.
| Compound Name | 1,3-difluorobenzene;formic acid |
|---|---|
| PubChem CID | 158586074 |
| Molecular Formula | C7H6F2O2 |
| Molecular Weight | 160.12 g/mol |
| Exact Mass | 160.03 |
| IUPAC Name | 1,3-difluorobenzene;formic acid |
| SMILES | Fc1cccc(F)c1.O=CO |
| InChI | InChI=1S/C6H4F2.CH2O2/c7-5-2-1-3-6(8)4-5;2-1-3/h1-4H;1H,(H,2,3) |
| InChIKey | HTVMXJUPTRXRRN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.12 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|