About 4-fluoro-2-hydroxybenzaldehyde;3-fluorophenol
4-fluoro-2-hydroxybenzaldehyde;3-fluorophenol (PubChem CID 159484859) has the molecular formula C13H10F2O3
and a molecular weight of 252.22 g/mol. Its IUPAC name is 4-fluoro-2-hydroxybenzaldehyde;3-fluorophenol.
Molecular Properties
| Compound Name | 4-fluoro-2-hydroxybenzaldehyde;3-fluorophenol |
| PubChem CID | 159484859 |
| Molecular Formula | C13H10F2O3 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 4-fluoro-2-hydroxybenzaldehyde;3-fluorophenol |
| SMILES | O=Cc1ccc(F)cc1O.Oc1cccc(F)c1 |
| InChI | InChI=1S/C7H5FO2.C6H5FO/c8-6-2-1-5(4-9)7(10)3-6;7-5-2-1-3-6(8)4-5/h1-4,10H;1-4,8H |
| InChIKey | LXLMRESXCIOQNE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-2-hydroxybenzaldehyde;3-fluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-2-hydroxybenzaldehyde;3-fluorophenol?
The IUPAC name of 4-fluoro-2-hydroxybenzaldehyde;3-fluorophenol (CID 159484859) is 4-fluoro-2-hydroxybenzaldehyde;3-fluorophenol.
What is the SMILES notation for 4-fluoro-2-hydroxybenzaldehyde;3-fluorophenol?
The canonical SMILES for 4-fluoro-2-hydroxybenzaldehyde;3-fluorophenol is O=Cc1ccc(F)cc1O.Oc1cccc(F)c1.
What is the InChIKey of 4-fluoro-2-hydroxybenzaldehyde;3-fluorophenol?
The InChIKey is LXLMRESXCIOQNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5FO2.C6H5FO/c8-6-2-1-5(4-9)7(10)3-6;7-5-2-1-3-6(8)4-5/h1-4,10H;1-4,8H.
What are the key properties of 4-fluoro-2-hydroxybenzaldehyde;3-fluorophenol?
4-fluoro-2-hydroxybenzaldehyde;3-fluorophenol has a molecular weight of 252.22 g/mol, XLogP of 2.88, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2-hydroxybenzaldehyde;3-fluorophenol is sourced from PubChem (CID 159484859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).