About ethane;1-fluoro-3-methylbenzene
ethane;1-fluoro-3-methylbenzene (PubChem CID 123790085) has the molecular formula C11H19F
and a molecular weight of 170.27 g/mol. Its IUPAC name is ethane;1-fluoro-3-methylbenzene.
Molecular Properties
| Compound Name | ethane;1-fluoro-3-methylbenzene |
| PubChem CID | 123790085 |
| Molecular Formula | C11H19F |
| Molecular Weight | 170.27 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | ethane;1-fluoro-3-methylbenzene |
| SMILES | CC.CC.Cc1cccc(F)c1 |
| InChI | InChI=1S/C7H7F.2C2H6/c1-6-3-2-4-7(8)5-6;2*1-2/h2-5H,1H3;2*1-2H3 |
| InChIKey | QPPPRWYOCLDFFE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.27 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;1-fluoro-3-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-fluoro-3-methylbenzene?
The IUPAC name of ethane;1-fluoro-3-methylbenzene (CID 123790085) is ethane;1-fluoro-3-methylbenzene.
What is the SMILES notation for ethane;1-fluoro-3-methylbenzene?
The canonical SMILES for ethane;1-fluoro-3-methylbenzene is CC.CC.Cc1cccc(F)c1.
What is the InChIKey of ethane;1-fluoro-3-methylbenzene?
The InChIKey is QPPPRWYOCLDFFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F.2C2H6/c1-6-3-2-4-7(8)5-6;2*1-2/h2-5H,1H3;2*1-2H3.
What are the key properties of ethane;1-fluoro-3-methylbenzene?
ethane;1-fluoro-3-methylbenzene has a molecular weight of 170.27 g/mol, XLogP of 4.19, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-fluoro-3-methylbenzene is sourced from PubChem (CID 123790085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).