About 2-chloro-1-fluoro-4-methylbenzene;1-fluoro-3-methylbenzene
2-chloro-1-fluoro-4-methylbenzene;1-fluoro-3-methylbenzene (PubChem CID 143200692) has the molecular formula C14H13ClF2
and a molecular weight of 254.71 g/mol. Its IUPAC name is 2-chloro-1-fluoro-4-methylbenzene;1-fluoro-3-methylbenzene.
Molecular Properties
| Compound Name | 2-chloro-1-fluoro-4-methylbenzene;1-fluoro-3-methylbenzene |
| PubChem CID | 143200692 |
| Molecular Formula | C14H13ClF2 |
| Molecular Weight | 254.71 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-chloro-1-fluoro-4-methylbenzene;1-fluoro-3-methylbenzene |
| SMILES | Cc1ccc(F)c(Cl)c1.Cc1cccc(F)c1 |
| InChI | InChI=1S/C7H6ClF.C7H7F/c1-5-2-3-7(9)6(8)4-5;1-6-3-2-4-7(8)5-6/h2-4H,1H3;2-5H,1H3 |
| InChIKey | PNTIQKCTUFAJTQ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.71 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-chloro-1-fluoro-4-methylbenzene;1-fluoro-3-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1-fluoro-4-methylbenzene;1-fluoro-3-methylbenzene?
The IUPAC name of 2-chloro-1-fluoro-4-methylbenzene;1-fluoro-3-methylbenzene (CID 143200692) is 2-chloro-1-fluoro-4-methylbenzene;1-fluoro-3-methylbenzene.
What is the SMILES notation for 2-chloro-1-fluoro-4-methylbenzene;1-fluoro-3-methylbenzene?
The canonical SMILES for 2-chloro-1-fluoro-4-methylbenzene;1-fluoro-3-methylbenzene is Cc1ccc(F)c(Cl)c1.Cc1cccc(F)c1.
What is the InChIKey of 2-chloro-1-fluoro-4-methylbenzene;1-fluoro-3-methylbenzene?
The InChIKey is PNTIQKCTUFAJTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClF.C7H7F/c1-5-2-3-7(9)6(8)4-5;1-6-3-2-4-7(8)5-6/h2-4H,1H3;2-5H,1H3.
What are the key properties of 2-chloro-1-fluoro-4-methylbenzene;1-fluoro-3-methylbenzene?
2-chloro-1-fluoro-4-methylbenzene;1-fluoro-3-methylbenzene has a molecular weight of 254.71 g/mol, XLogP of 4.92, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1-fluoro-4-methylbenzene;1-fluoro-3-methylbenzene is sourced from PubChem (CID 143200692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).