C15H16Cl2 — CID 158244707
1,2-dichloro-4-methylbenzene;1,3-xylene (PubChem CID 158244707) has the molecular formula C15H16Cl2 and a molecular weight of 267.20 g/mol. Its IUPAC name is 1,2-dichloro-4-methylbenzene;1,3-xylene.
| Compound Name | 1,2-dichloro-4-methylbenzene;1,3-xylene |
|---|---|
| PubChem CID | 158244707 |
| Molecular Formula | C15H16Cl2 |
| Molecular Weight | 267.20 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 1,2-dichloro-4-methylbenzene;1,3-xylene |
| SMILES | Cc1ccc(Cl)c(Cl)c1.Cc1cccc(C)c1 |
| InChI | InChI=1S/C8H10.C7H6Cl2/c1-7-4-3-5-8(2)6-7;1-5-2-3-6(8)7(9)4-5/h3-6H,1-2H3;2-4H,1H3 |
| InChIKey | GFYZYOICBHKMKX-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.20 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |