C7H6Cl2Zn — CID 174694337
1,2-dichloro-4-methylbenzene;zinc (PubChem CID 174694337) has the molecular formula C7H6Cl2Zn and a molecular weight of 226.42 g/mol. Its IUPAC name is 1,2-dichloro-4-methylbenzene;zinc.
| Compound Name | 1,2-dichloro-4-methylbenzene;zinc |
|---|---|
| PubChem CID | 174694337 |
| Molecular Formula | C7H6Cl2Zn |
| Molecular Weight | 226.42 g/mol |
| Exact Mass | 223.91 |
| IUPAC Name | 1,2-dichloro-4-methylbenzene;zinc |
| SMILES | Cc1ccc(Cl)c(Cl)c1.[Zn] |
| InChI | InChI=1S/C7H6Cl2.Zn/c1-5-2-3-6(8)7(9)4-5;/h2-4H,1H3; |
| InChIKey | BEENFMIUBWGNHY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|