C9H12ClN — CID 4099980
2-chloro-N,N,4-trimethylaniline (PubChem CID 4099980) has the molecular formula C9H12ClN and a molecular weight of 169.65 g/mol. Its IUPAC name is 2-chloro-N,N,4-trimethylaniline.
| Compound Name | 2-chloro-N,N,4-trimethylaniline |
|---|---|
| PubChem CID | 4099980 |
| Molecular Formula | C9H12ClN |
| Molecular Weight | 169.65 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 2-chloro-N,N,4-trimethylaniline |
| SMILES | Cc1ccc(N(C)C)c(Cl)c1 |
| InChI | InChI=1S/C9H12ClN/c1-7-4-5-9(11(2)3)8(10)6-7/h4-6H,1-3H3 |
| InChIKey | GPYYUDWDKLIISZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.65 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |