C15H15BrClN — CID 164602194
N-[3-(bromomethyl)phenyl]-2-chloro-N,4-dimethylaniline (PubChem CID 164602194) has the molecular formula C15H15BrClN and a molecular weight of 324.65 g/mol. Its IUPAC name is N-[3-(bromomethyl)phenyl]-2-chloro-N,4-dimethylaniline.
| Compound Name | N-[3-(bromomethyl)phenyl]-2-chloro-N,4-dimethylaniline |
|---|---|
| PubChem CID | 164602194 |
| Molecular Formula | C15H15BrClN |
| Molecular Weight | 324.65 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | N-[3-(bromomethyl)phenyl]-2-chloro-N,4-dimethylaniline |
| SMILES | Cc1ccc(N(C)c2cccc(CBr)c2)c(Cl)c1 |
| InChI | InChI=1S/C15H15BrClN/c1-11-6-7-15(14(17)8-11)18(2)13-5-3-4-12(9-13)10-16/h3-9H,10H2,1-2H3 |
| InChIKey | NRNKIBADIFGROR-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.65 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|