C11H15BrClN — CID 107078904
4-(bromomethyl)-2-chloro-N,N-diethylaniline (PubChem CID 107078904) has the molecular formula C11H15BrClN and a molecular weight of 276.61 g/mol. Its IUPAC name is 4-(bromomethyl)-2-chloro-N,N-diethylaniline.
| Compound Name | 4-(bromomethyl)-2-chloro-N,N-diethylaniline |
|---|---|
| PubChem CID | 107078904 |
| Molecular Formula | C11H15BrClN |
| Molecular Weight | 276.61 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 4-(bromomethyl)-2-chloro-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(CBr)cc1Cl |
| InChI | InChI=1S/C11H15BrClN/c1-3-14(4-2)11-6-5-9(8-12)7-10(11)13/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | RQWVBUMOSYEUML-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.61 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|