C11H12Cl2F3N — CID 81152373
2-chloro-4-(chloromethyl)-N-ethyl-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 81152373) has the molecular formula C11H12Cl2F3N and a molecular weight of 286.12 g/mol. Its IUPAC name is 2-chloro-4-(chloromethyl)-N-ethyl-N-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 2-chloro-4-(chloromethyl)-N-ethyl-N-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 81152373 |
| Molecular Formula | C11H12Cl2F3N |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 2-chloro-4-(chloromethyl)-N-ethyl-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | CCN(CC(F)(F)F)c1ccc(CCl)cc1Cl |
| InChI | InChI=1S/C11H12Cl2F3N/c1-2-17(7-11(14,15)16)10-4-3-8(6-12)5-9(10)13/h3-5H,2,6-7H2,1H3 |
| InChIKey | YCDKGFBFFRSIDB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|