C14H20ClF3N2O — CID 107481491
2-[2-chloro-4-(propylaminomethyl)-N-(2,2,2-trifluoroethyl)anilino]ethanol (PubChem CID 107481491) has the molecular formula C14H20ClF3N2O and a molecular weight of 324.77 g/mol. Its IUPAC name is 2-[2-chloro-4-(propylaminomethyl)-N-(2,2,2-trifluoroethyl)anilino]ethanol.
| Compound Name | 2-[2-chloro-4-(propylaminomethyl)-N-(2,2,2-trifluoroethyl)anilino]ethanol |
|---|---|
| PubChem CID | 107481491 |
| Molecular Formula | C14H20ClF3N2O |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 2-[2-chloro-4-(propylaminomethyl)-N-(2,2,2-trifluoroethyl)anilino]ethanol |
| SMILES | CCCNCc1ccc(N(CCO)CC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C14H20ClF3N2O/c1-2-5-19-9-11-3-4-13(12(15)8-11)20(6-7-21)10-14(16,17)18/h3-4,8,19,21H,2,5-7,9-10H2,1H3 |
| InChIKey | XVAHENVTMKGBJF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|