C15H23ClF2N2O — CID 107481469
2-[4-[(tert-butylamino)methyl]-2-chloro-N-(2,2-difluoroethyl)anilino]ethanol (PubChem CID 107481469) has the molecular formula C15H23ClF2N2O and a molecular weight of 320.81 g/mol. Its IUPAC name is 2-[4-[(tert-butylamino)methyl]-2-chloro-N-(2,2-difluoroethyl)anilino]ethanol.
| Compound Name | 2-[4-[(tert-butylamino)methyl]-2-chloro-N-(2,2-difluoroethyl)anilino]ethanol |
|---|---|
| PubChem CID | 107481469 |
| Molecular Formula | C15H23ClF2N2O |
| Molecular Weight | 320.81 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 2-[4-[(tert-butylamino)methyl]-2-chloro-N-(2,2-difluoroethyl)anilino]ethanol |
| SMILES | CC(C)(C)NCc1ccc(N(CCO)CC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C15H23ClF2N2O/c1-15(2,3)19-9-11-4-5-13(12(16)8-11)20(6-7-21)10-14(17)18/h4-5,8,14,19,21H,6-7,9-10H2,1-3H3 |
| InChIKey | QIXHTGZGKJXEDW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.81 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|