C15H24F2N2O — CID 107481467
2-[4-[(tert-butylamino)methyl]-N-(2,2-difluoroethyl)anilino]ethanol (PubChem CID 107481467) has the molecular formula C15H24F2N2O and a molecular weight of 286.37 g/mol. Its IUPAC name is 2-[4-[(tert-butylamino)methyl]-N-(2,2-difluoroethyl)anilino]ethanol.
| Compound Name | 2-[4-[(tert-butylamino)methyl]-N-(2,2-difluoroethyl)anilino]ethanol |
|---|---|
| PubChem CID | 107481467 |
| Molecular Formula | C15H24F2N2O |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 2-[4-[(tert-butylamino)methyl]-N-(2,2-difluoroethyl)anilino]ethanol |
| SMILES | CC(C)(C)NCc1ccc(N(CCO)CC(F)F)cc1 |
| InChI | InChI=1S/C15H24F2N2O/c1-15(2,3)18-10-12-4-6-13(7-5-12)19(8-9-20)11-14(16)17/h4-7,14,18,20H,8-11H2,1-3H3 |
| InChIKey | YHFPXIUTCGVIBF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|