C11H15F2N3O2 — CID 107480053
4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxybenzenecarboximidamide (PubChem CID 107480053) has the molecular formula C11H15F2N3O2 and a molecular weight of 259.26 g/mol. Its IUPAC name is 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 107480053 |
| Molecular Formula | C11H15F2N3O2 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccc(N(CCO)CC(F)F)cc1 |
| InChI | InChI=1S/C11H15F2N3O2/c12-10(13)7-16(5-6-17)9-3-1-8(2-4-9)11(14)15-18/h1-4,10,17-18H,5-7H2,(H2,14,15) |
| InChIKey | CDXFOUHMBRCOPK-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|