C11H13ClF2N2OS — CID 107479829
2-chloro-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]benzenecarbothioamide (PubChem CID 107479829) has the molecular formula C11H13ClF2N2OS and a molecular weight of 294.75 g/mol. Its IUPAC name is 2-chloro-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]benzenecarbothioamide.
| Compound Name | 2-chloro-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 107479829 |
| Molecular Formula | C11H13ClF2N2OS |
| Molecular Weight | 294.75 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 2-chloro-4-[2,2-difluoroethyl(2-hydroxyethyl)amino]benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(N(CCO)CC(F)F)cc1Cl |
| InChI | InChI=1S/C11H13ClF2N2OS/c12-9-5-7(1-2-8(9)11(15)18)16(3-4-17)6-10(13)14/h1-2,5,10,17H,3-4,6H2,(H2,15,18) |
| InChIKey | QXHMBEDNYHAQST-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.75 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|