C12H15F3N2O2S — CID 61234313
4-[bis(2-hydroxyethyl)amino]-2-(trifluoromethyl)benzenecarbothioamide (PubChem CID 61234313) has the molecular formula C12H15F3N2O2S and a molecular weight of 308.33 g/mol. Its IUPAC name is 4-[bis(2-hydroxyethyl)amino]-2-(trifluoromethyl)benzenecarbothioamide.
| Compound Name | 4-[bis(2-hydroxyethyl)amino]-2-(trifluoromethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 61234313 |
| Molecular Formula | C12H15F3N2O2S |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 4-[bis(2-hydroxyethyl)amino]-2-(trifluoromethyl)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(N(CCO)CCO)cc1C(F)(F)F |
| InChI | InChI=1S/C12H15F3N2O2S/c13-12(14,15)10-7-8(1-2-9(10)11(16)20)17(3-5-18)4-6-19/h1-2,7,18-19H,3-6H2,(H2,16,20) |
| InChIKey | HEZIQZFPCIGSPV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|