C11H15F3N2O2 — CID 61244638
2-[4-amino-N-(2-hydroxyethyl)-3-(trifluoromethyl)anilino]ethanol (PubChem CID 61244638) has the molecular formula C11H15F3N2O2 and a molecular weight of 264.25 g/mol. Its IUPAC name is 2-[4-amino-N-(2-hydroxyethyl)-3-(trifluoromethyl)anilino]ethanol.
| Compound Name | 2-[4-amino-N-(2-hydroxyethyl)-3-(trifluoromethyl)anilino]ethanol |
|---|---|
| PubChem CID | 61244638 |
| Molecular Formula | C11H15F3N2O2 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-[4-amino-N-(2-hydroxyethyl)-3-(trifluoromethyl)anilino]ethanol |
| SMILES | Nc1ccc(N(CCO)CCO)cc1C(F)(F)F |
| InChI | InChI=1S/C11H15F3N2O2/c12-11(13,14)9-7-8(1-2-10(9)15)16(3-5-17)4-6-18/h1-2,7,17-18H,3-6,15H2 |
| InChIKey | OHKGGMXVKMRVDL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|