C13H19F3N2 — CID 43269261
4-N-propan-2-yl-4-N-propyl-2-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 43269261) has the molecular formula C13H19F3N2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 4-N-propan-2-yl-4-N-propyl-2-(trifluoromethyl)benzene-1,4-diamine.
| Compound Name | 4-N-propan-2-yl-4-N-propyl-2-(trifluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 43269261 |
| Molecular Formula | C13H19F3N2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 4-N-propan-2-yl-4-N-propyl-2-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | CCCN(c1ccc(N)c(C(F)(F)F)c1)C(C)C |
| InChI | InChI=1S/C13H19F3N2/c1-4-7-18(9(2)3)10-5-6-12(17)11(8-10)13(14,15)16/h5-6,8-9H,4,7,17H2,1-3H3 |
| InChIKey | SNOKLHGRYQSIED-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|