C14H16BrF3N2 — CID 107081858
3-[4-(bromomethyl)-N-propan-2-yl-3-(trifluoromethyl)anilino]propanenitrile (PubChem CID 107081858) has the molecular formula C14H16BrF3N2 and a molecular weight of 349.19 g/mol. Its IUPAC name is 3-[4-(bromomethyl)-N-propan-2-yl-3-(trifluoromethyl)anilino]propanenitrile.
| Compound Name | 3-[4-(bromomethyl)-N-propan-2-yl-3-(trifluoromethyl)anilino]propanenitrile |
|---|---|
| PubChem CID | 107081858 |
| Molecular Formula | C14H16BrF3N2 |
| Molecular Weight | 349.19 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 3-[4-(bromomethyl)-N-propan-2-yl-3-(trifluoromethyl)anilino]propanenitrile |
| SMILES | CC(C)N(CCC#N)c1ccc(CBr)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16BrF3N2/c1-10(2)20(7-3-6-19)12-5-4-11(9-15)13(8-12)14(16,17)18/h4-5,8,10H,3,7,9H2,1-2H3 |
| InChIKey | QONGXNXLXXZULQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.19 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|