C14H19BrF3NO — CID 107082173
4-(bromomethyl)-N-ethyl-N-(1-methoxypropan-2-yl)-3-(trifluoromethyl)aniline (PubChem CID 107082173) has the molecular formula C14H19BrF3NO and a molecular weight of 354.21 g/mol. Its IUPAC name is 4-(bromomethyl)-N-ethyl-N-(1-methoxypropan-2-yl)-3-(trifluoromethyl)aniline.
| Compound Name | 4-(bromomethyl)-N-ethyl-N-(1-methoxypropan-2-yl)-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 107082173 |
| Molecular Formula | C14H19BrF3NO |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 4-(bromomethyl)-N-ethyl-N-(1-methoxypropan-2-yl)-3-(trifluoromethyl)aniline |
| SMILES | CCN(c1ccc(CBr)c(C(F)(F)F)c1)C(C)COC |
| InChI | InChI=1S/C14H19BrF3NO/c1-4-19(10(2)9-20-3)12-6-5-11(8-15)13(7-12)14(16,17)18/h5-7,10H,4,8-9H2,1-3H3 |
| InChIKey | QIMVLQUILHUDIR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|