C14H19BrF3N — CID 107082381
4-(bromomethyl)-N-(2,2-dimethylpropyl)-N-methyl-3-(trifluoromethyl)aniline (PubChem CID 107082381) has the molecular formula C14H19BrF3N and a molecular weight of 338.21 g/mol. Its IUPAC name is 4-(bromomethyl)-N-(2,2-dimethylpropyl)-N-methyl-3-(trifluoromethyl)aniline.
| Compound Name | 4-(bromomethyl)-N-(2,2-dimethylpropyl)-N-methyl-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 107082381 |
| Molecular Formula | C14H19BrF3N |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 4-(bromomethyl)-N-(2,2-dimethylpropyl)-N-methyl-3-(trifluoromethyl)aniline |
| SMILES | CN(CC(C)(C)C)c1ccc(CBr)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H19BrF3N/c1-13(2,3)9-19(4)11-6-5-10(8-15)12(7-11)14(16,17)18/h5-7H,8-9H2,1-4H3 |
| InChIKey | LUYGKYSSGULJSM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|