C14H19BrF3NS — CID 107084994
4-(bromomethyl)-N-methyl-N-(1-methylsulfanylbutan-2-yl)-3-(trifluoromethyl)aniline (PubChem CID 107084994) has the molecular formula C14H19BrF3NS and a molecular weight of 370.28 g/mol. Its IUPAC name is 4-(bromomethyl)-N-methyl-N-(1-methylsulfanylbutan-2-yl)-3-(trifluoromethyl)aniline.
| Compound Name | 4-(bromomethyl)-N-methyl-N-(1-methylsulfanylbutan-2-yl)-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 107084994 |
| Molecular Formula | C14H19BrF3NS |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 4-(bromomethyl)-N-methyl-N-(1-methylsulfanylbutan-2-yl)-3-(trifluoromethyl)aniline |
| SMILES | CCC(CSC)N(C)c1ccc(CBr)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H19BrF3NS/c1-4-11(9-20-3)19(2)12-6-5-10(8-15)13(7-12)14(16,17)18/h5-7,11H,4,8-9H2,1-3H3 |
| InChIKey | DNUVMJLMKRWGEP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|