C14H19F3N2S2 — CID 115985875
5-[methyl(1-methylsulfanylbutan-2-yl)amino]-2-(trifluoromethyl)benzenecarbothioamide (PubChem CID 115985875) has the molecular formula C14H19F3N2S2 and a molecular weight of 336.45 g/mol. Its IUPAC name is 5-[methyl(1-methylsulfanylbutan-2-yl)amino]-2-(trifluoromethyl)benzenecarbothioamide.
| Compound Name | 5-[methyl(1-methylsulfanylbutan-2-yl)amino]-2-(trifluoromethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 115985875 |
| Molecular Formula | C14H19F3N2S2 |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 5-[methyl(1-methylsulfanylbutan-2-yl)amino]-2-(trifluoromethyl)benzenecarbothioamide |
| SMILES | CCC(CSC)N(C)c1ccc(C(F)(F)F)c(C(N)=S)c1 |
| InChI | InChI=1S/C14H19F3N2S2/c1-4-9(8-21-3)19(2)10-5-6-12(14(15,16)17)11(7-10)13(18)20/h5-7,9H,4,8H2,1-3H3,(H2,18,20) |
| InChIKey | GXNFMSQYRFXWGJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|