C14H23NOS — CID 112661769
[2-methyl-4-[methyl(1-methylsulfanylbutan-2-yl)amino]phenyl]methanol (PubChem CID 112661769) has the molecular formula C14H23NOS and a molecular weight of 253.41 g/mol. Its IUPAC name is [2-methyl-4-[methyl(1-methylsulfanylbutan-2-yl)amino]phenyl]methanol.
| Compound Name | [2-methyl-4-[methyl(1-methylsulfanylbutan-2-yl)amino]phenyl]methanol |
|---|---|
| PubChem CID | 112661769 |
| Molecular Formula | C14H23NOS |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | [2-methyl-4-[methyl(1-methylsulfanylbutan-2-yl)amino]phenyl]methanol |
| SMILES | CCC(CSC)N(C)c1ccc(CO)c(C)c1 |
| InChI | InChI=1S/C14H23NOS/c1-5-13(10-17-4)15(3)14-7-6-12(9-16)11(2)8-14/h6-8,13,16H,5,9-10H2,1-4H3 |
| InChIKey | QEUNHQBCTNEJIR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|