C17H30N2S — CID 115988039
4-(2-aminobutyl)-N,3-dimethyl-N-(1-methylsulfanylbutan-2-yl)aniline (PubChem CID 115988039) has the molecular formula C17H30N2S and a molecular weight of 294.51 g/mol. Its IUPAC name is 4-(2-aminobutyl)-N,3-dimethyl-N-(1-methylsulfanylbutan-2-yl)aniline.
| Compound Name | 4-(2-aminobutyl)-N,3-dimethyl-N-(1-methylsulfanylbutan-2-yl)aniline |
|---|---|
| PubChem CID | 115988039 |
| Molecular Formula | C17H30N2S |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 4-(2-aminobutyl)-N,3-dimethyl-N-(1-methylsulfanylbutan-2-yl)aniline |
| SMILES | CCC(N)Cc1ccc(N(C)C(CC)CSC)cc1C |
| InChI | InChI=1S/C17H30N2S/c1-6-15(18)11-14-8-9-17(10-13(14)3)19(4)16(7-2)12-20-5/h8-10,15-16H,6-7,11-12,18H2,1-5H3 |
| InChIKey | BWEUNZSGHQHFIP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|