About 4-(2-aminobutyl)-3-methyl-N,N-dipropylaniline
4-(2-aminobutyl)-3-methyl-N,N-dipropylaniline (PubChem CID 63786915) has the molecular formula C17H30N2
and a molecular weight of 262.44 g/mol. Its IUPAC name is 4-(2-aminobutyl)-3-methyl-N,N-dipropylaniline.
Molecular Properties
| Compound Name | 4-(2-aminobutyl)-3-methyl-N,N-dipropylaniline |
| PubChem CID | 63786915 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | 4-(2-aminobutyl)-3-methyl-N,N-dipropylaniline |
| SMILES | CCCN(CCC)c1ccc(CC(N)CC)c(C)c1 |
| InChI | InChI=1S/C17H30N2/c1-5-10-19(11-6-2)17-9-8-15(14(4)12-17)13-16(18)7-3/h8-9,12,16H,5-7,10-11,13,18H2,1-4H3 |
| InChIKey | JETFHUMGVZRPEF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-aminobutyl)-3-methyl-N,N-dipropylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminobutyl)-3-methyl-N,N-dipropylaniline?
The IUPAC name of 4-(2-aminobutyl)-3-methyl-N,N-dipropylaniline (CID 63786915) is 4-(2-aminobutyl)-3-methyl-N,N-dipropylaniline.
What is the SMILES notation for 4-(2-aminobutyl)-3-methyl-N,N-dipropylaniline?
The canonical SMILES for 4-(2-aminobutyl)-3-methyl-N,N-dipropylaniline is CCCN(CCC)c1ccc(CC(N)CC)c(C)c1.
What is the InChIKey of 4-(2-aminobutyl)-3-methyl-N,N-dipropylaniline?
The InChIKey is JETFHUMGVZRPEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N2/c1-5-10-19(11-6-2)17-9-8-15(14(4)12-17)13-16(18)7-3/h8-9,12,16H,5-7,10-11,13,18H2,1-4H3.
What are the key properties of 4-(2-aminobutyl)-3-methyl-N,N-dipropylaniline?
4-(2-aminobutyl)-3-methyl-N,N-dipropylaniline has a molecular weight of 262.44 g/mol, XLogP of 3.90, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminobutyl)-3-methyl-N,N-dipropylaniline is sourced from PubChem (CID 63786915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).