C14H21F3N2 — CID 63795900
4-(2-aminobutyl)-N,3-dimethyl-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 63795900) has the molecular formula C14H21F3N2 and a molecular weight of 274.33 g/mol. Its IUPAC name is 4-(2-aminobutyl)-N,3-dimethyl-N-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 4-(2-aminobutyl)-N,3-dimethyl-N-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 63795900 |
| Molecular Formula | C14H21F3N2 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 4-(2-aminobutyl)-N,3-dimethyl-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | CCC(N)Cc1ccc(N(C)CC(F)(F)F)cc1C |
| InChI | InChI=1S/C14H21F3N2/c1-4-12(18)8-11-5-6-13(7-10(11)2)19(3)9-14(15,16)17/h5-7,12H,4,8-9,18H2,1-3H3 |
| InChIKey | MTPAEVBPTOFVMV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|