C12H16F3NO — CID 115257768
4-ethoxy-N,3-dimethyl-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 115257768) has the molecular formula C12H16F3NO and a molecular weight of 247.26 g/mol. Its IUPAC name is 4-ethoxy-N,3-dimethyl-N-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 4-ethoxy-N,3-dimethyl-N-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 115257768 |
| Molecular Formula | C12H16F3NO |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 4-ethoxy-N,3-dimethyl-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | CCOc1ccc(N(C)CC(F)(F)F)cc1C |
| InChI | InChI=1S/C12H16F3NO/c1-4-17-11-6-5-10(7-9(11)2)16(3)8-12(13,14)15/h5-7H,4,8H2,1-3H3 |
| InChIKey | NADBQFPBUXLFAF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|