C15H25N3O — CID 115229889
4-ethoxy-N,3-dimethyl-N-(piperazin-1-ylmethyl)aniline (PubChem CID 115229889) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is 4-ethoxy-N,3-dimethyl-N-(piperazin-1-ylmethyl)aniline.
| Compound Name | 4-ethoxy-N,3-dimethyl-N-(piperazin-1-ylmethyl)aniline |
|---|---|
| PubChem CID | 115229889 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 4-ethoxy-N,3-dimethyl-N-(piperazin-1-ylmethyl)aniline |
| SMILES | CCOc1ccc(N(C)CN2CCNCC2)cc1C |
| InChI | InChI=1S/C15H25N3O/c1-4-19-15-6-5-14(11-13(15)2)17(3)12-18-9-7-16-8-10-18/h5-6,11,16H,4,7-10,12H2,1-3H3 |
| InChIKey | GBTMAHYPUWLEPC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|