C15H26N2O — CID 115134578
3-N-(4-ethoxy-3-methylphenyl)-3-N,3-dimethylbutane-1,3-diamine (PubChem CID 115134578) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is 3-N-(4-ethoxy-3-methylphenyl)-3-N,3-dimethylbutane-1,3-diamine.
| Compound Name | 3-N-(4-ethoxy-3-methylphenyl)-3-N,3-dimethylbutane-1,3-diamine |
|---|---|
| PubChem CID | 115134578 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | 3-N-(4-ethoxy-3-methylphenyl)-3-N,3-dimethylbutane-1,3-diamine |
| SMILES | CCOc1ccc(N(C)C(C)(C)CCN)cc1C |
| InChI | InChI=1S/C15H26N2O/c1-6-18-14-8-7-13(11-12(14)2)17(5)15(3,4)9-10-16/h7-8,11H,6,9-10,16H2,1-5H3 |
| InChIKey | RMKQRCSLQLUSGW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|