C16H28N2 — CID 55237009
4-(2-aminobutyl)-N-(2,2-dimethylpropyl)-N-methylaniline (PubChem CID 55237009) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 4-(2-aminobutyl)-N-(2,2-dimethylpropyl)-N-methylaniline.
| Compound Name | 4-(2-aminobutyl)-N-(2,2-dimethylpropyl)-N-methylaniline |
|---|---|
| PubChem CID | 55237009 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 4-(2-aminobutyl)-N-(2,2-dimethylpropyl)-N-methylaniline |
| SMILES | CCC(N)Cc1ccc(N(C)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H28N2/c1-6-14(17)11-13-7-9-15(10-8-13)18(5)12-16(2,3)4/h7-10,14H,6,11-12,17H2,1-5H3 |
| InChIKey | NTIJIGZOOVQOQA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|