C14H24ClNO — CID 170889301
1-[4-[(2-methylpropan-2-yl)oxy]phenyl]butan-2-amine;hydrochloride (PubChem CID 170889301) has the molecular formula C14H24ClNO and a molecular weight of 257.81 g/mol. Its IUPAC name is 1-[4-[(2-methylpropan-2-yl)oxy]phenyl]butan-2-amine;hydrochloride.
| Compound Name | 1-[4-[(2-methylpropan-2-yl)oxy]phenyl]butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 170889301 |
| Molecular Formula | C14H24ClNO |
| Molecular Weight | 257.81 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 1-[4-[(2-methylpropan-2-yl)oxy]phenyl]butan-2-amine;hydrochloride |
| SMILES | CCC(N)Cc1ccc(OC(C)(C)C)cc1.Cl |
| InChI | InChI=1S/C14H23NO.ClH/c1-5-12(15)10-11-6-8-13(9-7-11)16-14(2,3)4;/h6-9,12H,5,10,15H2,1-4H3;1H |
| InChIKey | CESKVYLKAMXBLB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.81 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |