C14H23NO2 — CID 171271183
(1S,2R)-1-amino-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]butan-2-ol (PubChem CID 171271183) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]butan-2-ol.
| Compound Name | (1S,2R)-1-amino-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]butan-2-ol |
|---|---|
| PubChem CID | 171271183 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | (1S,2R)-1-amino-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]butan-2-ol |
| SMILES | CC[C@@H](O)[C@@H](N)c1ccc(OC(C)(C)C)cc1 |
| InChI | InChI=1S/C14H23NO2/c1-5-12(16)13(15)10-6-8-11(9-7-10)17-14(2,3)4/h6-9,12-13,16H,5,15H2,1-4H3/t12-,13+/m1/s1 |
| InChIKey | YTSXQADYJNDHOC-OLZOCXBDSA-N |
| XLogP | 2.63 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |