C19H30O3 — CID 152566620
tert-butyl 2-[4-[(2-methylpropan-2-yl)oxy]phenyl]pentanoate (PubChem CID 152566620) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is tert-butyl 2-[4-[(2-methylpropan-2-yl)oxy]phenyl]pentanoate.
| Compound Name | tert-butyl 2-[4-[(2-methylpropan-2-yl)oxy]phenyl]pentanoate |
|---|---|
| PubChem CID | 152566620 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | tert-butyl 2-[4-[(2-methylpropan-2-yl)oxy]phenyl]pentanoate |
| SMILES | CCCC(C(=O)OC(C)(C)C)c1ccc(OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H30O3/c1-8-9-16(17(20)22-19(5,6)7)14-10-12-15(13-11-14)21-18(2,3)4/h10-13,16H,8-9H2,1-7H3 |
| InChIKey | YQPOZMDCFPLFJB-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |