About [4-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]propan-2-yl]phenyl] 2-methylpentanoate
[4-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]propan-2-yl]phenyl] 2-methylpentanoate (PubChem CID 145094437) has the molecular formula C25H34O3
and a molecular weight of 382.54 g/mol. Its IUPAC name is [4-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]propan-2-yl]phenyl] 2-methylpentanoate.
Molecular Properties
| Compound Name | [4-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]propan-2-yl]phenyl] 2-methylpentanoate |
| PubChem CID | 145094437 |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | [4-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]propan-2-yl]phenyl] 2-methylpentanoate |
| SMILES | CCCC(C)C(=O)Oc1ccc(C(C)(C)c2ccc(OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H34O3/c1-8-9-18(2)23(26)27-21-14-10-19(11-15-21)25(6,7)20-12-16-22(17-13-20)28-24(3,4)5/h10-18H,8-9H2,1-7H3 |
| InChIKey | VJUWASJVTXOLKF-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]propan-2-yl]phenyl] 2-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]propan-2-yl]phenyl] 2-methylpentanoate?
The IUPAC name of [4-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]propan-2-yl]phenyl] 2-methylpentanoate (CID 145094437) is [4-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]propan-2-yl]phenyl] 2-methylpentanoate.
What is the SMILES notation for [4-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]propan-2-yl]phenyl] 2-methylpentanoate?
The canonical SMILES for [4-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]propan-2-yl]phenyl] 2-methylpentanoate is CCCC(C)C(=O)Oc1ccc(C(C)(C)c2ccc(OC(C)(C)C)cc2)cc1.
What is the InChIKey of [4-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]propan-2-yl]phenyl] 2-methylpentanoate?
The InChIKey is VJUWASJVTXOLKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H34O3/c1-8-9-18(2)23(26)27-21-14-10-19(11-15-21)25(6,7)20-12-16-22(17-13-20)28-24(3,4)5/h10-18H,8-9H2,1-7H3.
What are the key properties of [4-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]propan-2-yl]phenyl] 2-methylpentanoate?
[4-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]propan-2-yl]phenyl] 2-methylpentanoate has a molecular weight of 382.54 g/mol, XLogP of 6.53, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]propan-2-yl]phenyl] 2-methylpentanoate is sourced from PubChem (CID 145094437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).