C28H32O3 — CID 122522972
[4-[1-[4-[(2-methylpropan-2-yl)oxy]phenyl]-1-phenylethyl]phenyl] 2-methylpropanoate (PubChem CID 122522972) has the molecular formula C28H32O3 and a molecular weight of 416.56 g/mol. Its IUPAC name is [4-[1-[4-[(2-methylpropan-2-yl)oxy]phenyl]-1-phenylethyl]phenyl] 2-methylpropanoate.
| Compound Name | [4-[1-[4-[(2-methylpropan-2-yl)oxy]phenyl]-1-phenylethyl]phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 122522972 |
| Molecular Formula | C28H32O3 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | [4-[1-[4-[(2-methylpropan-2-yl)oxy]phenyl]-1-phenylethyl]phenyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)Oc1ccc(C(C)(c2ccccc2)c2ccc(OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H32O3/c1-20(2)26(29)30-24-16-12-22(13-17-24)28(6,21-10-8-7-9-11-21)23-14-18-25(19-15-23)31-27(3,4)5/h7-20H,1-6H3 |
| InChIKey | GNTVYYLRIUDPBP-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|