About methane;[4-[1-(4-methoxyphenyl)-1-phenylethyl]phenyl] acetate
methane;[4-[1-(4-methoxyphenyl)-1-phenylethyl]phenyl] acetate (PubChem CID 157158688) has the molecular formula C24H26O3
and a molecular weight of 362.47 g/mol. Its IUPAC name is methane;[4-[1-(4-methoxyphenyl)-1-phenylethyl]phenyl] acetate.
Molecular Properties
| Compound Name | methane;[4-[1-(4-methoxyphenyl)-1-phenylethyl]phenyl] acetate |
| PubChem CID | 157158688 |
| Molecular Formula | C24H26O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | methane;[4-[1-(4-methoxyphenyl)-1-phenylethyl]phenyl] acetate |
| SMILES | C.COc1ccc(C(C)(c2ccccc2)c2ccc(OC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C23H22O3.CH4/c1-17(24)26-22-15-11-20(12-16-22)23(2,18-7-5-4-6-8-18)19-9-13-21(25-3)14-10-19;/h4-16H,1-3H3;1H4 |
| InChIKey | AMCQQZMHXNDYDC-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze methane;[4-[1-(4-methoxyphenyl)-1-phenylethyl]phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;[4-[1-(4-methoxyphenyl)-1-phenylethyl]phenyl] acetate?
The IUPAC name of methane;[4-[1-(4-methoxyphenyl)-1-phenylethyl]phenyl] acetate (CID 157158688) is methane;[4-[1-(4-methoxyphenyl)-1-phenylethyl]phenyl] acetate.
What is the SMILES notation for methane;[4-[1-(4-methoxyphenyl)-1-phenylethyl]phenyl] acetate?
The canonical SMILES for methane;[4-[1-(4-methoxyphenyl)-1-phenylethyl]phenyl] acetate is C.COc1ccc(C(C)(c2ccccc2)c2ccc(OC(C)=O)cc2)cc1.
What is the InChIKey of methane;[4-[1-(4-methoxyphenyl)-1-phenylethyl]phenyl] acetate?
The InChIKey is AMCQQZMHXNDYDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22O3.CH4/c1-17(24)26-22-15-11-20(12-16-22)23(2,18-7-5-4-6-8-18)19-9-13-21(25-3)14-10-19;/h4-16H,1-3H3;1H4.
What are the key properties of methane;[4-[1-(4-methoxyphenyl)-1-phenylethyl]phenyl] acetate?
methane;[4-[1-(4-methoxyphenyl)-1-phenylethyl]phenyl] acetate has a molecular weight of 362.47 g/mol, XLogP of 5.61, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;[4-[1-(4-methoxyphenyl)-1-phenylethyl]phenyl] acetate is sourced from PubChem (CID 157158688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).