C73H66O9 — CID 161219499
[4-[(4-methoxyphenyl)-diphenylmethyl]phenyl] acetate;[4-[1-(4-methoxyphenyl)-1-phenylethyl]phenyl] acetate;[4-[(4-methoxyphenyl)-phenylmethyl]phenyl] acetate (PubChem CID 161219499) has the molecular formula C73H66O9 and a molecular weight of 1087.32 g/mol. Its IUPAC name is [4-[(4-methoxyphenyl)-diphenylmethyl]phenyl] acetate;[4-[1-(4-methoxyphenyl)-1-phenylethyl]phenyl] acetate;[4-[(4-methoxyphenyl)-phenylmethyl]phenyl] acetate.
| Compound Name | [4-[(4-methoxyphenyl)-diphenylmethyl]phenyl] acetate;[4-[1-(4-methoxyphenyl)-1-phenylethyl]phenyl] acetate;[4-[(4-methoxyphenyl)-phenylmethyl]phenyl] acetate |
|---|---|
| PubChem CID | 161219499 |
| Molecular Formula | C73H66O9 |
| Molecular Weight | 1087.32 g/mol |
| Exact Mass | 1086.47 |
| IUPAC Name | [4-[(4-methoxyphenyl)-diphenylmethyl]phenyl] acetate;[4-[1-(4-methoxyphenyl)-1-phenylethyl]phenyl] acetate;[4-[(4-methoxyphenyl)-phenylmethyl]phenyl] acetate |
| SMILES | COc1ccc(C(C)(c2ccccc2)c2ccc(OC(C)=O)cc2)cc1.COc1ccc(C(c2ccccc2)(c2ccccc2)c2ccc(OC(C)=O)cc2)cc1.COc1ccc(C(c2ccccc2)c2ccc(OC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C28H24O3.C23H22O3.C22H20O3/c1-21(29)31-27-19-15-25(16-20-27)28(22-9-5-3-6-10-22,23-11-7-4-8-12-23)24-13-17-26(30-2)18-14-24;1-17(24)26-22-15-11-20(12-16-22)23(2,18-7-5-4-6-8-18)19-9-13-21(25-3)14-10-19;1-16(23)25-21-14-10-19(11-15-21)22(17-6-4-3-5-7-17)18-8-12-20(24-2)13-9-18/h3-20H,1-2H3;4-16H,1-3H3;3-15,22H,1-2H3 |
| InChIKey | UXHXVSQCAAOJGQ-UHFFFAOYSA-N |
| XLogP | 15.78 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1087.32 |
| LogP ≤ 5 | 15.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|