C24H24O6W — CID 20709048
acetic acid;[4-[1-(4-methoxyphenyl)-1-phenylethyl]phenyl] hydrogen carbonate;tungsten (PubChem CID 20709048) has the molecular formula C24H24O6W and a molecular weight of 592.29 g/mol. Its IUPAC name is acetic acid;[4-[1-(4-methoxyphenyl)-1-phenylethyl]phenyl] hydrogen carbonate;tungsten.
| Compound Name | acetic acid;[4-[1-(4-methoxyphenyl)-1-phenylethyl]phenyl] hydrogen carbonate;tungsten |
|---|---|
| PubChem CID | 20709048 |
| Molecular Formula | C24H24O6W |
| Molecular Weight | 592.29 g/mol |
| Exact Mass | 592.11 |
| IUPAC Name | acetic acid;[4-[1-(4-methoxyphenyl)-1-phenylethyl]phenyl] hydrogen carbonate;tungsten |
| SMILES | CC(=O)O.COc1ccc(C(C)(c2ccccc2)c2ccc(OC(=O)O)cc2)cc1.[W] |
| InChI | InChI=1S/C22H20O4.C2H4O2.W/c1-22(16-6-4-3-5-7-16,17-8-12-19(25-2)13-9-17)18-10-14-20(15-11-18)26-21(23)24;1-2(3)4;/h3-15H,1-2H3,(H,23,24);1H3,(H,3,4); |
| InChIKey | GHDYWDFYTBLHOC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.29 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|