C31H36O5 — CID 142863748
[4-[1-[4-(2,2-dimethylpropanoyloxy)phenyl]-1-(4-methoxyphenyl)ethyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 142863748) has the molecular formula C31H36O5 and a molecular weight of 488.62 g/mol. Its IUPAC name is [4-[1-[4-(2,2-dimethylpropanoyloxy)phenyl]-1-(4-methoxyphenyl)ethyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[1-[4-(2,2-dimethylpropanoyloxy)phenyl]-1-(4-methoxyphenyl)ethyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 142863748 |
| Molecular Formula | C31H36O5 |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | [4-[1-[4-(2,2-dimethylpropanoyloxy)phenyl]-1-(4-methoxyphenyl)ethyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | COc1ccc(C(C)(c2ccc(OC(=O)C(C)(C)C)cc2)c2ccc(OC(=O)C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C31H36O5/c1-29(2,3)27(32)35-25-17-11-22(12-18-25)31(7,21-9-15-24(34-8)16-10-21)23-13-19-26(20-14-23)36-28(33)30(4,5)6/h9-20H,1-8H3 |
| InChIKey | ARIXSKCCCRBBLK-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|